![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| Ale'a/ | 2026-01-31 17:36 | - | |
| Aloha Pumehana Serenaders/ | 2026-01-31 12:35 | - | |
| Amy Gilliom & Willie K/ | 2026-01-31 17:25 | - | |
| Amy Hânaiali'i Gilliom/ | 2025-12-23 20:58 | - | |
| Amy Hanaiali'i/ | 2026-01-31 16:14 | - | |
| Amy Hanaiali'i Gilliom with Willie K/ | 2026-01-31 14:10 | - | |
| Ata Damasco/ | 2026-01-31 15:35 | - | |
| Ata Damasco wth C. Pueo Pata, and Kaialohia Smith/ | 2025-12-31 20:01 | - | |
| Auntie Ida Keli'i Chun/ | 2026-01-31 13:57 | - | |
| Barney Isaacs and George Kuo/ | 2026-01-31 09:33 | - | |
| Bobby Ingano/ | 2026-01-31 17:06 | - | |
| Braddah Smitty/ | 2026-01-31 12:50 | - | |
| Brother Noland & Tony Conjugacion/ | 2025-12-23 20:58 | - | |
| C. Pueo Pata/ | 2026-01-01 02:20 | - | |
| Chris Yeaton/ | 2025-12-23 20:58 | - | |
| Cody 'Pueo' Pata/ | 2026-01-31 10:58 | - | |
| Cyril Pahinui & Bob Brozman/ | 2026-01-31 17:28 | - | |
| Cyril Pahinui/ | 2026-01-31 18:00 | - | |
| Daniel Ho/ | 2025-12-23 20:58 | - | |
| Darlene Ahuna/ | 2026-01-31 16:17 | - | |
| Darren Benitez/ | 2026-01-31 11:22 | - | |
| Dennis Kamakahi/ | 2026-01-31 12:55 | - | |
| Dennis Pavao/ | 2026-01-31 12:18 | - | |
| Eddie Kamae/ | 2026-01-31 16:24 | - | |
| Eddie Kamae and Friends/ | 2025-12-23 20:58 | - | |
| Eric Lee/ | 2026-01-31 11:08 | - | |
| Faith Ako/ | 2026-01-31 10:33 | - | |
| G-Girl Keli'iho'omalu/ | 2026-01-31 12:39 | - | |
| Gabby Pahinui/ | 2026-01-31 14:54 | - | |
| Gabby Pahinui and The Sons of Hawaii/ | 2026-01-31 12:22 | - | |
| Genoa Keawe/ | 2026-01-31 17:51 | - | |
| George Kahumoku Jr. & Bob Brozman/ | 2025-12-23 20:58 | - | |
| George Kahumoku Jr. & Daniel Ho/ | 2026-01-31 11:45 | - | |
| George Kahumoku Jr./ | 2026-01-31 13:41 | - | |
| Halau Hula Olana/ | 2026-01-31 09:22 | - | |
| Hapa/ | 2026-01-31 15:50 | - | |
| Hawaiian All Star Band/ | 2026-01-31 10:00 | - | |
| HawaiianRainbow.com ID/ | 2026-01-31 17:56 | - | |
| HawaiianRainbow/ | 2026-01-31 17:46 | - | |
| Hawaiian Style Band/ | 2026-01-31 16:38 | - | |
| Hema Pa'a/ | 2026-01-31 15:43 | - | |
| Herb Ohta Jr./ | 2025-12-23 20:58 | - | |
| Ho'okena/ | 2026-01-31 14:21 | - | |
| Holunape/ | 2025-12-23 20:58 | - | |
| Hui Aloha/ | 2026-01-31 16:48 | - | |
| Hulu Lindsey/ | 2026-01-31 12:02 | - | |
| Ike Pono/ | 2026-01-31 14:45 | - | |
| Imipono Cabrinha/ | 2026-01-31 12:44 | - | |
| Island Stars/ | 2026-01-31 12:46 | - | |
| Israel Kamakawiwo'ole/ | 2026-01-31 15:45 | - | |
| James ''Kimo'' West/ | 2026-01-01 03:21 | - | |
| Jeff Au Hoy/ | 2026-01-31 15:02 | - | |
| Jeff Peterson/ | 2025-12-23 20:58 | - | |
| Jim ''Kimo'' West/ | 2026-01-01 02:57 | - | |
| John Cruz/ | 2025-12-23 20:58 | - | |
| John Ka'imikaua/ | 2026-01-31 09:42 | - | |
| John Keawe/ | 2026-01-31 17:03 | - | |
| John Serkin/ | 2026-01-31 16:21 | - | |
| Josh Tatofi/ | 2026-01-31 11:25 | - | |
| Ka Pilina/ | 2025-12-23 20:58 | - | |
| Kahauanu Lake Singers/ | 2026-01-31 14:56 | - | |
| Kahauanu Lake Trio/ | 2026-01-31 16:34 | - | |
| Kainani Kahaunaele/ | 2026-01-31 17:39 | - | |
| Kapena/ | 2026-01-31 16:10 | - | |
| Kawaikapuokalani Hewett/ | 2026-01-31 16:32 | - | |
| Kawika Alfiche/ | 2026-01-31 14:06 | - | |
| Ke'alohi/ | 2026-01-31 16:00 | - | |
| Keahiwai/ | 2026-01-01 00:01 | - | |
| Keali'i Reichel/ | 2026-01-31 15:56 | - | |
| Kealoha Kalamaw/ | 2026-01-31 15:37 | - | |
| Keauhou/ | 2026-01-31 10:46 | - | |
| Keith & Carmen Haugen/ | 2025-12-23 20:58 | - | |
| Kekuhi Kanahele/ | 2025-12-23 20:58 | - | |
| Keli'i Kaneali'i/ | 2026-01-31 16:59 | - | |
| Ken Emerson and Friends/ | 2026-01-31 14:12 | - | |
| Keola Beamer/ | 2026-01-31 14:32 | - | |
| Ki ho alu Christmas (Hawaiian Slack Key Guitar)/ | 2026-01-01 03:51 | - | |
| Kimo Alama Keaulana and Lei Hulu/ | 2026-01-31 16:41 | - | |
| Ku'uipo Kumukahi/ | 2026-01-31 16:27 | - | |
| Kuana Torres Kahele/ | 2025-12-23 20:58 | - | |
| Kupaoa/ | 2026-01-31 09:51 | - | |
| Laeimana Abenes/ | 2025-12-31 19:30 | - | |
| Led Kaapana/ | 2026-01-31 14:49 | - | |
| Ledward Kaapana/ | 2026-01-31 17:41 | - | |
| Ledward Kaapana and the New Ikona/ | 2026-01-31 13:22 | - | |
| Lei'ohu Ryder/ | 2026-01-01 03:54 | - | |
| LeokÄne Pryor & Jim ''Kimo'' West/ | 2026-01-31 10:12 | - | |
| Leonard Kwan/ | 2026-01-31 10:07 | - | |
| Lim Family/ | 2026-01-31 15:08 | - | |
| Makaha Sons Of Ni'ihau/ | 2025-12-23 20:58 | - | |
| Makaha Sons and Friends/ | 2026-01-31 13:53 | - | |
| Mark Keali'i Ho'omalu/ | 2026-01-31 13:06 | - | |
| Marlene Sai/ | 2026-01-31 14:00 | - | |
| Martin Pahinui/ | 2025-12-23 20:58 | - | |
| Maui Jam/ | 2026-01-31 14:41 | - | |
| Maunalua/ | 2026-01-31 17:16 | - | |
| Moe Keale/ | 2026-01-31 11:56 | - | |
| NÄ Wai Ê» EhÄ/ | 2026-01-31 17:45 | - | |
| Na Hoa/ | 2026-01-31 17:10 | - | |
| Na Kama/ | 2026-01-31 13:13 | - | |
| Na Leo Pilimehana/ | 2026-01-01 03:24 | - | |
| Na Palapalai/ | 2025-12-23 20:58 | - | |
| Napua Makua/ | 2026-01-01 01:08 | - | |
| Natalie Ai Kamauu/ | 2026-01-31 11:42 | - | |
| Nathan Aweau/ | 2025-12-23 20:58 | - | |
| Noelani And The Leo NaheNahe Singers/ | 2026-01-01 03:14 | - | |
| Ozzie Kotani/ | 2026-01-31 14:02 | - | |
| Ozzie Kotani And Steve Sano/ | 2025-12-23 20:58 | - | |
| Pahinui Hawaiian Band/ | 2026-01-31 13:29 | - | |
| Pandanus Club/ | 2025-12-23 20:58 | - | |
| Peter Moon Band/ | 2025-12-23 20:58 | - | |
| Raiatea Helm/ | 2026-01-31 15:17 | - | |
| Ray Kane/ | 2026-01-31 15:12 | - | |
| Robert Cazimero/ | 2025-12-23 20:58 | - | |
| Sean Na'auao/ | 2026-01-01 02:18 | - | |
| Sonny Lim/ | 2026-01-31 14:17 | - | |
| Sterling Seaton/ | 2026-01-31 15:47 | - | |
| Steven Espaniola/ | 2025-12-23 20:58 | - | |
| Sunday Manoa/ | 2026-01-31 13:49 | - | |
| The Brothers Cazimero/ | 2026-01-01 02:23 | - | |
| The Hula Honeys/ | 2026-01-31 13:15 | - | |
| The Kahumoku Brothers/ | 2026-01-31 17:49 | - | |
| Uluwehi Guerrero/ | 2026-01-31 13:19 | - | |
| Various/ | 2026-01-31 14:59 | - | |
| Various Artists/ | 2026-01-01 03:32 | - | |
| Vicki Ii and Her Family/ | 2026-01-31 10:18 | - | |
| Waipuna/ | 2026-01-31 17:55 | - | |
| Walter Niesing/ | 2026-01-31 14:51 | - | |
| Willie K/ | 2026-01-01 03:08 | - | |
| incomplete/ | 2026-01-31 18:00 | - | |
| logs/ | 2025-12-23 20:58 | - | |
| unknown/ | 2025-12-23 20:58 | - | |
| 2025-12-31_1855_hawaiian-rainbow-test.err | 2025-12-31 18:55 | 0 | |
| 2026-01-31_0903_hawaiian-rainbow-test.err | 2026-01-31 09:03 | 0 | |
| 2026_01_31_15_03_43__.mp3 | 2026-01-31 16:55 | 1.8M | |
| 2026_01_31_15_03_43__ (1).mp3 | 2026-01-31 15:29 | 2.9M | |
| 2026-01-31_0903_hawaiian-rainbow-test.out | 2026-01-31 18:03 | 3.8M | |
| 2025-12-31_1855_hawaiian-rainbow-test.out | 2026-01-01 03:55 | 4.3M | |